C20H29NO2 — CID 101214253
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R)-1-phenylethyl]iminoacetate (PubChem CID 101214253) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R)-1-phenylethyl]iminoacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R)-1-phenylethyl]iminoacetate |
|---|---|
| PubChem CID | 101214253 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R)-1-phenylethyl]iminoacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)/C=N/[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H29NO2/c1-14(2)18-11-10-15(3)12-19(18)23-20(22)13-21-16(4)17-8-6-5-7-9-17/h5-9,13-16,18-19H,10-12H2,1-4H3/b21-13+/t15-,16-,18+,19-/m1/s1 |
| InChIKey | HVKJNWWQZKXLHW-OHZFGSDYSA-N |
| XLogP | 4.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|