C19H29NO3 — CID 174669057
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3-aminophenyl)-2-methoxyacetate (PubChem CID 174669057) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-aminophenyl)-2-methoxyacetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-aminophenyl)-2-methoxyacetate |
|---|---|
| PubChem CID | 174669057 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-aminophenyl)-2-methoxyacetate |
| SMILES | COC(C(=O)OC1CC(C)CCC1C(C)C)c1cccc(N)c1 |
| InChI | InChI=1S/C19H29NO3/c1-12(2)16-9-8-13(3)10-17(16)23-19(21)18(22-4)14-6-5-7-15(20)11-14/h5-7,11-13,16-18H,8-10,20H2,1-4H3 |
| InChIKey | ZGFKDRQMUYIZOC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|