C26H31NO5 — CID 23789860
1-O-[2-(3-aminophenyl)-2-oxoethyl] 2-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,2-dicarboxylate (PubChem CID 23789860) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-O-[2-(3-aminophenyl)-2-oxoethyl] 2-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(3-aminophenyl)-2-oxoethyl] 2-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23789860 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-O-[2-(3-aminophenyl)-2-oxoethyl] 2-O-(5-methyl-2-propan-2-ylcyclohexyl) benzene-1,2-dicarboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccccc2C(=O)OCC(=O)c2cccc(N)c2)C1 |
| InChI | InChI=1S/C26H31NO5/c1-16(2)20-12-11-17(3)13-24(20)32-26(30)22-10-5-4-9-21(22)25(29)31-15-23(28)18-7-6-8-19(27)14-18/h4-10,14,16-17,20,24H,11-13,15,27H2,1-3H3 |
| InChIKey | ZVNGATXLEBHELW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|