C30H36BrO2P — CID 18558600
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]-triphenylphosphanium bromide (PubChem CID 18558600) has the molecular formula C30H36BrO2P and a molecular weight of 539.49 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]-triphenylphosphanium bromide.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 18558600 |
| Molecular Formula | C30H36BrO2P |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl]-triphenylphosphanium bromide |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C30H36O2P.BrH/c1-23(2)28-20-19-24(3)21-29(28)32-30(31)22-33(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27;/h4-18,23-24,28-29H,19-22H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | MTIQFBXNDNRCDL-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|