C18H27NO2 — CID 61308508
(5-methyl-2-propan-2-ylcyclohexyl) 2-(2-aminophenyl)acetate (PubChem CID 61308508) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(2-aminophenyl)acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(2-aminophenyl)acetate |
|---|---|
| PubChem CID | 61308508 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(2-aminophenyl)acetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)Cc2ccccc2N)C1 |
| InChI | InChI=1S/C18H27NO2/c1-12(2)15-9-8-13(3)10-17(15)21-18(20)11-14-6-4-5-7-16(14)19/h4-7,12-13,15,17H,8-11,19H2,1-3H3 |
| InChIKey | MXVNXAGZHIFQSK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|