C20H30O3 — CID 149190489
[(1R,2S)-5-methyl-2-propan-2-ylcyclohexyl] 3-hydroxy-3-phenylbutanoate (PubChem CID 149190489) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(1R,2S)-5-methyl-2-propan-2-ylcyclohexyl] 3-hydroxy-3-phenylbutanoate.
| Compound Name | [(1R,2S)-5-methyl-2-propan-2-ylcyclohexyl] 3-hydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 149190489 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(1R,2S)-5-methyl-2-propan-2-ylcyclohexyl] 3-hydroxy-3-phenylbutanoate |
| SMILES | CC1CC[C@@H](C(C)C)[C@H](OC(=O)CC(C)(O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H30O3/c1-14(2)17-11-10-15(3)12-18(17)23-19(21)13-20(4,22)16-8-6-5-7-9-16/h5-9,14-15,17-18,22H,10-13H2,1-4H3/t15?,17-,18+,20?/m0/s1 |
| InChIKey | XCSNAQQRBMYFQF-MHALHIKHSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |