C16H32N2O2 — CID 120829592
N-[2-(methylamino)propyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide (PubChem CID 120829592) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide.
| Compound Name | N-[2-(methylamino)propyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide |
|---|---|
| PubChem CID | 120829592 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N-[2-(methylamino)propyl]-2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetamide |
| SMILES | CNC(C)CNC(=O)COC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-11(2)14-7-6-12(3)8-15(14)20-10-16(19)18-9-13(4)17-5/h11-15,17H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | HVEUHARJCDVANN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |