C17H22ClNO4 — CID 3638839
(5-methyl-2-propan-2-ylcyclohexyl) 2-chloro-4-nitrobenzoate (PubChem CID 3638839) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-chloro-4-nitrobenzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 3638839 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-chloro-4-nitrobenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C17H22ClNO4/c1-10(2)13-6-4-11(3)8-16(13)23-17(20)14-7-5-12(19(21)22)9-15(14)18/h5,7,9-11,13,16H,4,6,8H2,1-3H3 |
| InChIKey | CZYVCGVPYRVQGM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|