C18H25NO4 — CID 11869906
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methyl-3-nitrobenzoate (PubChem CID 11869906) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 11869906 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H]2C[C@@H](C)CC[C@@H]2C(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25NO4/c1-11(2)15-8-5-12(3)9-17(15)23-18(20)14-7-6-13(4)16(10-14)19(21)22/h6-7,10-12,15,17H,5,8-9H2,1-4H3/t12-,15+,17-/m0/s1 |
| InChIKey | XINZBBUNEQVDIC-MJEQTWJJSA-N |
| XLogP | 4.52 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|