C18H23NO2 — CID 14380212
(5-methyl-2-propan-2-ylcyclohexyl) 4-cyanobenzoate (PubChem CID 14380212) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 4-cyanobenzoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-cyanobenzoate |
|---|---|
| PubChem CID | 14380212 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 4-cyanobenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C18H23NO2/c1-12(2)16-9-4-13(3)10-17(16)21-18(20)15-7-5-14(11-19)6-8-15/h5-8,12-13,16-17H,4,9-10H2,1-3H3 |
| InChIKey | FJUXFXWPKXKEFT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |