C27H41NO4 — CID 11885671
5-O-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] pyridine-2,5-dicarboxylate (PubChem CID 11885671) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is 5-O-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] pyridine-2,5-dicarboxylate.
| Compound Name | 5-O-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 11885671 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 5-O-[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-O-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl] pyridine-2,5-dicarboxylate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@H]1OC(=O)c1ccc(C(=O)O[C@@H]2C[C@H](C)CC[C@@H]2C(C)C)nc1 |
| InChI | InChI=1S/C27H41NO4/c1-16(2)21-10-7-18(5)13-24(21)31-26(29)20-9-12-23(28-15-20)27(30)32-25-14-19(6)8-11-22(25)17(3)4/h9,12,15-19,21-22,24-25H,7-8,10-11,13-14H2,1-6H3/t18-,19+,21+,22+,24+,25+/m0/s1 |
| InChIKey | YVGHRWBIWYVRGP-ZULOBAKESA-N |
| XLogP | 6.32 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |