C16H22BrNO2 — CID 66462192
(5-methyl-2-propan-2-ylcyclohexyl) 6-bromopyridine-3-carboxylate (PubChem CID 66462192) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 6-bromopyridine-3-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 6-bromopyridine-3-carboxylate |
|---|---|
| PubChem CID | 66462192 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 6-bromopyridine-3-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccc(Br)nc2)C1 |
| InChI | InChI=1S/C16H22BrNO2/c1-10(2)13-6-4-11(3)8-14(13)20-16(19)12-5-7-15(17)18-9-12/h5,7,9-11,13-14H,4,6,8H2,1-3H3 |
| InChIKey | SKIYMOYVHAKOSQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|