C24H23N3O9 — CID 101479881
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4,5,7-trinitro-9-oxofluorene-2-carboxylate (PubChem CID 101479881) has the molecular formula C24H23N3O9 and a molecular weight of 497.46 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4,5,7-trinitro-9-oxofluorene-2-carboxylate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4,5,7-trinitro-9-oxofluorene-2-carboxylate |
|---|---|
| PubChem CID | 101479881 |
| Molecular Formula | C24H23N3O9 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 4,5,7-trinitro-9-oxofluorene-2-carboxylate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)c1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C24H23N3O9/c1-11(2)15-5-4-12(3)6-20(15)36-24(29)13-7-16-21(18(8-13)26(32)33)22-17(23(16)28)9-14(25(30)31)10-19(22)27(34)35/h7-12,15,20H,4-6H2,1-3H3/t12-,15+,20-/m0/s1 |
| InChIKey | OHLGRIUICWNIMY-VHPWJVAPSA-N |
| XLogP | 5.24 |
| TPSA | 172.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|