C20H27NO8S — CID 24653200
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 24653200) has the molecular formula C20H27NO8S and a molecular weight of 441.50 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 24653200 |
| Molecular Formula | C20H27NO8S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)COC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C20H27NO8S/c1-12(2)15-7-5-13(3)9-17(15)29-19(22)11-28-20(23)14-6-8-18(30(4,26)27)16(10-14)21(24)25/h6,8,10,12-13,15,17H,5,7,9,11H2,1-4H3 |
| InChIKey | ATWQAAQIKJQUBD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|