C19H26ClNO4 — CID 25421262
[2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 25421262) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is [2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 25421262 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1OC(=O)COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C19H26ClNO4/c1-11(2)14-6-4-12(3)8-17(14)25-18(22)10-24-19(23)13-5-7-15(20)16(21)9-13/h5,7,9,11-12,14,17H,4,6,8,10,21H2,1-3H3/t12-,14-,17+/m1/s1 |
| InChIKey | VNQLIMPBSFXHNV-MRRJBJDNSA-N |
| XLogP | 4.08 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|