C19H25IO4 — CID 4017621
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-iodobenzoate (PubChem CID 4017621) has the molecular formula C19H25IO4 and a molecular weight of 444.31 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-iodobenzoate.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 4017621 |
| Molecular Formula | C19H25IO4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-iodobenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)COC(=O)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C19H25IO4/c1-12(2)16-9-4-13(3)10-17(16)24-18(21)11-23-19(22)14-5-7-15(20)8-6-14/h5-8,12-13,16-17H,4,9-11H2,1-3H3 |
| InChIKey | ZJDHXMIUYBZZJY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|