C19H26N2O6 — CID 25419681
[2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 25419681) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 4-amino-3-nitrobenzoate.
| Compound Name | [2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 25419681 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [2-[(1S,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1OC(=O)COC(=O)c1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H26N2O6/c1-11(2)14-6-4-12(3)8-17(14)27-18(22)10-26-19(23)13-5-7-15(20)16(9-13)21(24)25/h5,7,9,11-12,14,17H,4,6,8,10,20H2,1-3H3/t12-,14-,17+/m1/s1 |
| InChIKey | VWOATUHOIAJERM-MRRJBJDNSA-N |
| XLogP | 3.34 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|