C26H31ClN2O9S — CID 25036155
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 2-chloro-5-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate (PubChem CID 25036155) has the molecular formula C26H31ClN2O9S and a molecular weight of 583.06 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 2-chloro-5-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 2-chloro-5-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25036155 |
| Molecular Formula | C26H31ClN2O9S |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 2-chloro-5-[(2-methoxy-5-nitrophenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)OC2CC(C)CCC2C(C)C)c1 |
| InChI | InChI=1S/C26H31ClN2O9S/c1-15(2)19-8-5-16(3)11-24(19)38-25(30)14-37-26(31)20-13-18(7-9-21(20)27)39(34,35)28-22-12-17(29(32)33)6-10-23(22)36-4/h6-7,9-10,12-13,15-16,19,24,28H,5,8,11,14H2,1-4H3 |
| InChIKey | LFHCJEBECNLZOR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|