C19H19ClN2O7S — CID 42983563
(2-methoxy-5-nitrophenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 42983563) has the molecular formula C19H19ClN2O7S and a molecular weight of 454.89 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-methoxy-5-nitrophenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42983563 |
| Molecular Formula | C19H19ClN2O7S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | (2-methoxy-5-nitrophenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1COC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C19H19ClN2O7S/c1-28-18-7-4-14(22(24)25)10-13(18)12-29-19(23)16-11-15(5-6-17(16)20)30(26,27)21-8-2-3-9-21/h4-7,10-11H,2-3,8-9,12H2,1H3 |
| InChIKey | RLHYRJBUNKSCRF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|