C20H22ClNO5S — CID 55384474
(2-methoxy-5-methylphenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 55384474) has the molecular formula C20H22ClNO5S and a molecular weight of 423.92 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-methoxy-5-methylphenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55384474 |
| Molecular Formula | C20H22ClNO5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 2-chloro-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(C)cc1COC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C20H22ClNO5S/c1-14-5-8-19(26-2)15(11-14)13-27-20(23)17-12-16(6-7-18(17)21)28(24,25)22-9-3-4-10-22/h5-8,11-12H,3-4,9-10,13H2,1-2H3 |
| InChIKey | UIODDCCORJZVTB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |