C21H22ClNO7S — CID 3513631
(5-acetyl-2-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 3513631) has the molecular formula C21H22ClNO7S and a molecular weight of 467.93 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3513631 |
| Molecular Formula | C21H22ClNO7S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C21H22ClNO7S/c1-14(24)15-3-6-20(28-2)16(11-15)13-30-21(25)18-12-17(4-5-19(18)22)31(26,27)23-7-9-29-10-8-23/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | FWQZAJRZRMNXEP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |