C20H21Cl2NO7S — CID 2448565
(2,6-dichlorophenyl)methyl 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2448565) has the molecular formula C20H21Cl2NO7S and a molecular weight of 490.36 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2448565 |
| Molecular Formula | C20H21Cl2NO7S |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2,3-dimethoxy-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1cc(S(=O)(=O)N2CCOCC2)cc(C(=O)OCc2c(Cl)cccc2Cl)c1OC |
| InChI | InChI=1S/C20H21Cl2NO7S/c1-27-18-11-13(31(25,26)23-6-8-29-9-7-23)10-14(19(18)28-2)20(24)30-12-15-16(21)4-3-5-17(15)22/h3-5,10-11H,6-9,12H2,1-2H3 |
| InChIKey | RUUBXROGOLNGEL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |