C19H21NO6S — CID 7811749
(3-morpholin-4-ylsulfonylphenyl)methyl 2-methoxybenzoate (PubChem CID 7811749) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 2-methoxybenzoate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-methoxybenzoate |
|---|---|
| PubChem CID | 7811749 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H21NO6S/c1-24-18-8-3-2-7-17(18)19(21)26-14-15-5-4-6-16(13-15)27(22,23)20-9-11-25-12-10-20/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | SMSLBOLGTGHBTL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |