C20H19NO5S2 — CID 7887439
(3-morpholin-4-ylsulfonylphenyl)methyl 1-benzothiophene-2-carboxylate (PubChem CID 7887439) has the molecular formula C20H19NO5S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 1-benzothiophene-2-carboxylate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7887439 |
| Molecular Formula | C20H19NO5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 1-benzothiophene-2-carboxylate |
| SMILES | O=C(OCc1cccc(S(=O)(=O)N2CCOCC2)c1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C20H19NO5S2/c22-20(19-13-16-5-1-2-7-18(16)27-19)26-14-15-4-3-6-17(12-15)28(23,24)21-8-10-25-11-9-21/h1-7,12-13H,8-11,14H2 |
| InChIKey | ZLIWLKCBZJWMSV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |