C18H17ClFNO5S — CID 7826009
(3-morpholin-4-ylsulfonylphenyl)methyl 2-chloro-4-fluorobenzoate (PubChem CID 7826009) has the molecular formula C18H17ClFNO5S and a molecular weight of 413.85 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 2-chloro-4-fluorobenzoate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 7826009 |
| Molecular Formula | C18H17ClFNO5S |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 2-chloro-4-fluorobenzoate |
| SMILES | O=C(OCc1cccc(S(=O)(=O)N2CCOCC2)c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H17ClFNO5S/c19-17-11-14(20)4-5-16(17)18(22)26-12-13-2-1-3-15(10-13)27(23,24)21-6-8-25-9-7-21/h1-5,10-11H,6-9,12H2 |
| InChIKey | KIANUQHMTUYQLY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |