C18H20N2O6S — CID 9385964
(3-morpholin-4-ylsulfonylphenyl)methyl 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9385964) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9385964 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c[nH]c(C(=O)OCc2cccc(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-13(21)15-10-17(19-11-15)18(22)26-12-14-3-2-4-16(9-14)27(23,24)20-5-7-25-8-6-20/h2-4,9-11,19H,5-8,12H2,1H3 |
| InChIKey | RGXWXQSAOCHTDM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |