C22H28N2O7S2 — CID 42978879
(3-morpholin-4-ylsulfonylphenyl)methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate (PubChem CID 42978879) has the molecular formula C22H28N2O7S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42978879 |
| Molecular Formula | C22H28N2O7S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 3-[methyl(propan-2-yl)sulfamoyl]benzoate |
| SMILES | CC(C)N(C)S(=O)(=O)c1cccc(C(=O)OCc2cccc(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C22H28N2O7S2/c1-17(2)23(3)32(26,27)21-9-5-7-19(15-21)22(25)31-16-18-6-4-8-20(14-18)33(28,29)24-10-12-30-13-11-24/h4-9,14-15,17H,10-13,16H2,1-3H3 |
| InChIKey | LCHZTJOZRLFDQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |