C17H24N2O6S — CID 7699367
[2-(diethylamino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7699367) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7699367 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H24N2O6S/c1-3-18(4-2)16(20)13-25-17(21)14-6-5-7-15(12-14)26(22,23)19-8-10-24-11-9-19/h5-7,12H,3-4,8-11,13H2,1-2H3 |
| InChIKey | BQUBZFONDUUUKQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |