C15H22N2O5S — CID 7960641
[2-(diethylamino)-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 7960641) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7960641 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-5-17(6-2)14(18)11-22-15(19)12-8-7-9-13(10-12)23(20,21)16(3)4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | HBFMHNHWRAVLGV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |