C19H30N2O5S — CID 2505781
[2-[di(propan-2-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 2505781) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2505781 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)N(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C19H30N2O5S/c1-7-20(8-2)27(24,25)17-11-9-10-16(12-17)19(23)26-13-18(22)21(14(3)4)15(5)6/h9-12,14-15H,7-8,13H2,1-6H3 |
| InChIKey | CIXYRPYRGPUJBL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |