About [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate
[(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 2505878) has the molecular formula C14H18N2O4S
and a molecular weight of 310.38 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate |
| PubChem CID | 2505878 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)O[C@H](C)C#N)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-4-16(5-2)21(18,19)13-8-6-7-12(9-13)14(17)20-11(3)10-15/h6-9,11H,4-5H2,1-3H3/t11-/m1/s1 |
| InChIKey | JBPHVQJEDNNEDF-LLVKDONJSA-N |
| XLogP | 1.79 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate?
The IUPAC name of [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate (CID 2505878) is [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate.
What is the SMILES notation for [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate?
The canonical SMILES for [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate is CCN(CC)S(=O)(=O)c1cccc(C(=O)O[C@H](C)C#N)c1.
What is the InChIKey of [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate?
The InChIKey is JBPHVQJEDNNEDF-LLVKDONJSA-N. The full InChI is InChI=1S/C14H18N2O4S/c1-4-16(5-2)21(18,19)13-8-6-7-12(9-13)14(17)20-11(3)10-15/h6-9,11H,4-5H2,1-3H3/t11-/m1/s1.
What are the key properties of [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate?
[(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate has a molecular weight of 310.38 g/mol, XLogP of 1.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanoethyl] 3-(diethylsulfamoyl)benzoate is sourced from PubChem (CID 2505878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).