C24H22N2O5S — CID 2598645
[(1R)-1-cyanoethyl] 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 2598645) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | [(1R)-1-cyanoethyl] 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2598645 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [(1R)-1-cyanoethyl] 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(N(Cc2ccccc2)S(=O)(=O)c2cccc(C(=O)O[C@H](C)C#N)c2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-18(16-25)31-24(27)20-9-6-10-23(15-20)32(28,29)26(17-19-7-4-3-5-8-19)21-11-13-22(30-2)14-12-21/h3-15,18H,17H2,1-2H3/t18-/m1/s1 |
| InChIKey | XSWKBTOFJLPQSL-GOSISDBHSA-N |
| XLogP | 4.16 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |