C27H30N2O6S — CID 2574935
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-[(4-methoxyphenyl)-methylsulfamoyl]benzoate (PubChem CID 2574935) has the molecular formula C27H30N2O6S and a molecular weight of 510.61 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-[(4-methoxyphenyl)-methylsulfamoyl]benzoate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-[(4-methoxyphenyl)-methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2574935 |
| Molecular Formula | C27H30N2O6S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 3-[(4-methoxyphenyl)-methylsulfamoyl]benzoate |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)OCC(=O)N(Cc3ccccc3)C(C)C)c2)cc1 |
| InChI | InChI=1S/C27H30N2O6S/c1-20(2)29(18-21-9-6-5-7-10-21)26(30)19-35-27(31)22-11-8-12-25(17-22)36(32,33)28(3)23-13-15-24(34-4)16-14-23/h5-17,20H,18-19H2,1-4H3 |
| InChIKey | PMLDFVONSZPQLL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |