C27H29NO6S — CID 2598663
(3,3-dimethyl-2-oxobutyl) 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 2598663) has the molecular formula C27H29NO6S and a molecular weight of 495.60 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2598663 |
| Molecular Formula | C27H29NO6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 3-[benzyl-(4-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(N(Cc2ccccc2)S(=O)(=O)c2cccc(C(=O)OCC(=O)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C27H29NO6S/c1-27(2,3)25(29)19-34-26(30)21-11-8-12-24(17-21)35(31,32)28(18-20-9-6-5-7-10-20)22-13-15-23(33-4)16-14-22/h5-17H,18-19H2,1-4H3 |
| InChIKey | BUUBZRRGHJLWSA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |