C24H23NO5S — CID 18286020
3-oxobutan-2-yl 3-[benzyl(phenyl)sulfamoyl]benzoate (PubChem CID 18286020) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-oxobutan-2-yl 3-[benzyl(phenyl)sulfamoyl]benzoate.
| Compound Name | 3-oxobutan-2-yl 3-[benzyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 18286020 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-oxobutan-2-yl 3-[benzyl(phenyl)sulfamoyl]benzoate |
| SMILES | CC(=O)C(C)OC(=O)c1cccc(S(=O)(=O)N(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO5S/c1-18(26)19(2)30-24(27)21-12-9-15-23(16-21)31(28,29)25(22-13-7-4-8-14-22)17-20-10-5-3-6-11-20/h3-16,19H,17H2,1-2H3 |
| InChIKey | APBUNODSXFFMNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |