C26H26N2O5S — CID 2595869
[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 2595869) has the molecular formula C26H26N2O5S and a molecular weight of 478.57 g/mol. Its IUPAC name is [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2595869 |
| Molecular Formula | C26H26N2O5S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 3-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O5S/c1-4-18-28(23-15-9-6-10-16-23)34(31,32)24-17-11-12-21(19-24)26(30)33-20(2)25(29)27(3)22-13-7-5-8-14-22/h4-17,19-20H,1,18H2,2-3H3/t20-/m0/s1 |
| InChIKey | PZJOPUSOBTYAIU-FQEVSTJZSA-N |
| XLogP | 4.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|