C25H22ClNO5S — CID 2609446
[(2R)-1-oxo-1-phenylpropan-2-yl] 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 2609446) has the molecular formula C25H22ClNO5S and a molecular weight of 483.97 g/mol. Its IUPAC name is [(2R)-1-oxo-1-phenylpropan-2-yl] 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [(2R)-1-oxo-1-phenylpropan-2-yl] 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2609446 |
| Molecular Formula | C25H22ClNO5S |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [(2R)-1-oxo-1-phenylpropan-2-yl] 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1cccc(C(=O)O[C@H](C)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H22ClNO5S/c1-3-16-27(22-14-12-21(26)13-15-22)33(30,31)23-11-7-10-20(17-23)25(29)32-18(2)24(28)19-8-5-4-6-9-19/h3-15,17-18H,1,16H2,2H3/t18-/m1/s1 |
| InChIKey | IUKMAJWLWKFYNC-GOSISDBHSA-N |
| XLogP | 5.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|