C20H19F3N2O5S — CID 2550254
[(2S)-1-amino-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 2550254) has the molecular formula C20H19F3N2O5S and a molecular weight of 456.44 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2550254 |
| Molecular Formula | C20H19F3N2O5S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(N)=O)c1 |
| InChI | InChI=1S/C20H19F3N2O5S/c1-3-10-25(16-8-5-7-15(12-16)20(21,22)23)31(28,29)17-9-4-6-14(11-17)19(27)30-13(2)18(24)26/h3-9,11-13H,1,10H2,2H3,(H2,24,26)/t13-/m0/s1 |
| InChIKey | ODFVLFPCOQLMNS-ZDUSSCGKSA-N |
| XLogP | 3.12 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|