C23H23F3N2O7S2 — CID 4840267
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 4840267) has the molecular formula C23H23F3N2O7S2 and a molecular weight of 560.57 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4840267 |
| Molecular Formula | C23H23F3N2O7S2 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C23H23F3N2O7S2/c1-2-10-28(19-7-4-6-17(13-19)23(24,25)26)37(33,34)20-8-3-5-16(12-20)22(30)35-14-21(29)27-18-9-11-36(31,32)15-18/h2-8,12-13,18H,1,9-11,14-15H2,(H,27,29) |
| InChIKey | ZARZJHKPCWZPLC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|