C23H24F3N3O6S — CID 4267951
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 4267951) has the molecular formula C23H24F3N3O6S and a molecular weight of 527.52 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4267951 |
| Molecular Formula | C23H24F3N3O6S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-[prop-2-enyl-[3-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | C=CCN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1cccc(C(=O)OCC(=O)NC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C23H24F3N3O6S/c1-4-11-29(18-9-6-8-17(13-18)23(24,25)26)36(33,34)19-10-5-7-16(12-19)21(31)35-14-20(30)28-22(32)27-15(2)3/h4-10,12-13,15H,1,11,14H2,2-3H3,(H2,27,28,30,32) |
| InChIKey | LZDFHFKIYREIIA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|