C14H19N3O6S — CID 2417052
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 2417052) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2417052 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)NC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C14H19N3O6S/c1-9(2)16-14(20)17-12(18)8-23-13(19)10-5-4-6-11(7-10)24(21,22)15-3/h4-7,9,15H,8H2,1-3H3,(H2,16,17,18,20) |
| InChIKey | PVXBYBDJNSMHCQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |