C18H18Cl2N2O5S — CID 46789450
[2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 46789450) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46789450 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)NC(C)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H18Cl2N2O5S/c1-11(12-6-7-15(19)16(20)9-12)22-17(23)10-27-18(24)13-4-3-5-14(8-13)28(25,26)21-2/h3-9,11,21H,10H2,1-2H3,(H,22,23) |
| InChIKey | WAMDYQOGQOMKFG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |