C17H15Cl3N2O5S — CID 46792843
[2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 46792843) has the molecular formula C17H15Cl3N2O5S and a molecular weight of 465.74 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46792843 |
| Molecular Formula | C17H15Cl3N2O5S |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CC(NC(=O)COC(=O)c1cc(S(N)(=O)=O)ccc1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl3N2O5S/c1-9(10-2-4-14(19)15(20)6-10)22-16(23)8-27-17(24)12-7-11(28(21,25)26)3-5-13(12)18/h2-7,9H,8H2,1H3,(H,22,23)(H2,21,25,26) |
| InChIKey | FLECNUNKIKEFKI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |