C14H15F3N2O4 — CID 2504258
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(trifluoromethyl)benzoate (PubChem CID 2504258) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2504258 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 3-(trifluoromethyl)benzoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2O4/c1-8(2)18-13(22)19-11(20)7-23-12(21)9-4-3-5-10(6-9)14(15,16)17/h3-6,8H,7H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | CABHDXDLMOEALH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |