C16H19F3N2O4 — CID 9014607
[2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 3-(trifluoromethyl)benzoate (PubChem CID 9014607) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 9014607 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 3-(trifluoromethyl)benzoate |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)COC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3N2O4/c1-3-7-20-14(23)10(2)21-13(22)9-25-15(24)11-5-4-6-12(8-11)16(17,18)19/h4-6,8,10H,3,7,9H2,1-2H3,(H,20,23)(H,21,22)/t10-/m0/s1 |
| InChIKey | OQNKDEFVARNDBX-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |