C23H18F3NO3 — CID 4854042
[2-(benzhydrylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 4854042) has the molecular formula C23H18F3NO3 and a molecular weight of 413.40 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 4854042 |
| Molecular Formula | C23H18F3NO3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(C(F)(F)F)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18F3NO3/c24-23(25,26)19-13-7-12-18(14-19)22(29)30-15-20(28)27-21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,21H,15H2,(H,27,28) |
| InChIKey | LSTOWJQUYSSVDC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |