C22H18F3NO3S — CID 46828730
[2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 46828730) has the molecular formula C22H18F3NO3S and a molecular weight of 433.45 g/mol. Its IUPAC name is [2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 46828730 |
| Molecular Formula | C22H18F3NO3S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [2-oxo-2-[[phenyl(thiophen-2-yl)methyl]amino]ethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(COC(=O)Cc1cccc(C(F)(F)F)c1)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C22H18F3NO3S/c23-22(24,25)17-9-4-6-15(12-17)13-20(28)29-14-19(27)26-21(18-10-5-11-30-18)16-7-2-1-3-8-16/h1-12,21H,13-14H2,(H,26,27) |
| InChIKey | PHIDHEYYPBCSMS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |