C13H13F3N2O4 — CID 8013675
[2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 8013675) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 8013675 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CC(=O)NNC(=O)COC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O4/c1-8(19)17-18-11(20)7-22-12(21)6-9-3-2-4-10(5-9)13(14,15)16/h2-5H,6-7H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | RZMYGXJFBKDCCS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|