C18H13F3N2O3 — CID 2338285
[2-(3-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 2338285) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 2338285 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | N#Cc1cccc(NC(=O)COC(=O)Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H13F3N2O3/c19-18(20,21)14-5-1-3-12(7-14)9-17(25)26-11-16(24)23-15-6-2-4-13(8-15)10-22/h1-8H,9,11H2,(H,23,24) |
| InChIKey | NRMACLNZSWMSHO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |