C18H12ClF3N2O3 — CID 7767405
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 7767405) has the molecular formula C18H12ClF3N2O3 and a molecular weight of 396.75 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 7767405 |
| Molecular Formula | C18H12ClF3N2O3 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)Cc2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C18H12ClF3N2O3/c19-15-8-14(5-4-12(15)9-23)24-16(25)10-27-17(26)7-11-2-1-3-13(6-11)18(20,21)22/h1-6,8H,7,10H2,(H,24,25) |
| InChIKey | RXISIGFWUMMMSQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |